C20H15NO4S — CID 91743952
(4Z)-4-[(2Z)-2-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]ethylidene]isochromene-1,3-dione (PubChem CID 91743952) has the molecular formula C20H15NO4S and a molecular weight of 365.41 g/mol. Its IUPAC name is (4Z)-4-[(2Z)-2-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]ethylidene]isochromene-1,3-dione.
| Compound Name | (4Z)-4-[(2Z)-2-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]ethylidene]isochromene-1,3-dione |
|---|---|
| PubChem CID | 91743952 |
| Molecular Formula | C20H15NO4S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (4Z)-4-[(2Z)-2-[3-(2-hydroxyethyl)-1,3-benzothiazol-2-ylidene]ethylidene]isochromene-1,3-dione |
| SMILES | O=C1OC(=O)c2ccccc2/C1=C/C=C1\Sc2ccccc2N1CCO |
| InChI | InChI=1S/C20H15NO4S/c22-12-11-21-16-7-3-4-8-17(16)26-18(21)10-9-15-13-5-1-2-6-14(13)19(23)25-20(15)24/h1-10,22H,11-12H2/b15-9-,18-10- |
| InChIKey | QIKMLMXNHQYFJI-XLHPTYDUSA-N |
| XLogP | 3.21 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|