C24H18N2O2S — CID 58082016
(4Z)-4-[(2Z)-2-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 58082016) has the molecular formula C24H18N2O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is (4Z)-4-[(2Z)-2-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[(2Z)-2-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 58082016 |
| Molecular Formula | C24H18N2O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (4Z)-4-[(2Z)-2-(3-ethylbenzo[g][1,3]benzothiazol-2-ylidene)ethylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | CCN1/C(=C/C=C2\C(=O)ON=C2c2ccccc2)Sc2c1ccc1ccccc21 |
| InChI | InChI=1S/C24H18N2O2S/c1-2-26-20-14-12-16-8-6-7-11-18(16)23(20)29-21(26)15-13-19-22(25-28-24(19)27)17-9-4-3-5-10-17/h3-15H,2H2,1H3/b19-13-,21-15- |
| InChIKey | OUIWOSACXORWDF-AYEUEKJESA-N |
| XLogP | 5.50 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|