C32H25N2O6S- — CID 22952531
3-[(2E)-2-[(E)-3-cyano-4-(4-methoxynaphthalen-1-yl)-4-oxobut-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate (PubChem CID 22952531) has the molecular formula C32H25N2O6S- and a molecular weight of 565.63 g/mol. Its IUPAC name is 3-[(2E)-2-[(E)-3-cyano-4-(4-methoxynaphthalen-1-yl)-4-oxobut-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate.
| Compound Name | 3-[(2E)-2-[(E)-3-cyano-4-(4-methoxynaphthalen-1-yl)-4-oxobut-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 22952531 |
| Molecular Formula | C32H25N2O6S- |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 3-[(2E)-2-[(E)-3-cyano-4-(4-methoxynaphthalen-1-yl)-4-oxobut-2-enylidene]-5-phenyl-1,3-benzoxazol-3-yl]propane-1-sulfonate |
| SMILES | COc1ccc(C(=O)/C(C#N)=C/C=C2/Oc3ccc(-c4ccccc4)cc3N2CCCS(=O)(=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C32H26N2O6S/c1-39-29-16-14-27(25-10-5-6-11-26(25)29)32(35)24(21-33)13-17-31-34(18-7-19-41(36,37)38)28-20-23(12-15-30(28)40-31)22-8-3-2-4-9-22/h2-6,8-17,20H,7,18-19H2,1H3,(H,36,37,38)/p-1/b24-13+,31-17+ |
| InChIKey | AZIYANNSNLKLHC-FCAPOERFSA-M |
| XLogP | 5.82 |
| TPSA | 119.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|