C49H31N7O4 — CID 72607118
4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-(N-phenylanilino)cyclopent-2-en-1-ylidene]-1,1,3-tricyanohexa-2,4-dien-2-yl]benzoic acid (PubChem CID 72607118) has the molecular formula C49H31N7O4 and a molecular weight of 781.83 g/mol. Its IUPAC name is 4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-(N-phenylanilino)cyclopent-2-en-1-ylidene]-1,1,3-tricyanohexa-2,4-dien-2-yl]benzoic acid.
| Compound Name | 4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-(N-phenylanilino)cyclopent-2-en-1-ylidene]-1,1,3-tricyanohexa-2,4-dien-2-yl]benzoic acid |
|---|---|
| PubChem CID | 72607118 |
| Molecular Formula | C49H31N7O4 |
| Molecular Weight | 781.83 g/mol |
| Exact Mass | 781.24 |
| IUPAC Name | 4-[6-[3-[5-(4-carboxyphenyl)-4,6-dicyano-6-isocyanohexa-1,3,5-trienyl]-2-(N-phenylanilino)cyclopent-2-en-1-ylidene]-1,1,3-tricyanohexa-2,4-dien-2-yl]benzoic acid |
| SMILES | [C-]#[N+]C(C#N)=C(C(C#N)=CC=CC1=C(N(c2ccccc2)c2ccccc2)C(=CC=CC(C#N)=C(c2ccc(C(=O)O)cc2)C(C#N)C#N)CC1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C49H31N7O4/c1-55-44(32-54)46(34-20-26-38(27-21-34)49(59)60)40(29-51)13-9-11-36-23-22-35(47(36)56(42-14-4-2-5-15-42)43-16-6-3-7-17-43)10-8-12-39(28-50)45(41(30-52)31-53)33-18-24-37(25-19-33)48(57)58/h2-21,24-27,41H,22-23H2,(H,57,58)(H,59,60) |
| InChIKey | BHJUYRSTLDNUMW-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 201.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.83 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|