C40H30N8O — CID 88558373
(3Z,5E)-6-[(3E)-2-(4-formylpiperazin-1-yl)-3-[(2E,4E)-4,6,6-tricyano-5-phenylhexa-2,4-dienylidene]cyclopenten-1-yl]-2-phenylhexa-1,3,5-triene-1,1,3-tricarbonitrile (PubChem CID 88558373) has the molecular formula C40H30N8O and a molecular weight of 638.74 g/mol. Its IUPAC name is (3Z,5E)-6-[(3E)-2-(4-formylpiperazin-1-yl)-3-[(2E,4E)-4,6,6-tricyano-5-phenylhexa-2,4-dienylidene]cyclopenten-1-yl]-2-phenylhexa-1,3,5-triene-1,1,3-tricarbonitrile.
| Compound Name | (3Z,5E)-6-[(3E)-2-(4-formylpiperazin-1-yl)-3-[(2E,4E)-4,6,6-tricyano-5-phenylhexa-2,4-dienylidene]cyclopenten-1-yl]-2-phenylhexa-1,3,5-triene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 88558373 |
| Molecular Formula | C40H30N8O |
| Molecular Weight | 638.74 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | (3Z,5E)-6-[(3E)-2-(4-formylpiperazin-1-yl)-3-[(2E,4E)-4,6,6-tricyano-5-phenylhexa-2,4-dienylidene]cyclopenten-1-yl]-2-phenylhexa-1,3,5-triene-1,1,3-tricarbonitrile |
| SMILES | N#CC(C#N)=C(/C(C#N)=C/C=C/C1=C(N2CCN(C=O)CC2)/C(=C/C=C/C(C#N)=C(\c2ccccc2)C(C#N)C#N)CC1)c1ccccc1 |
| InChI | InChI=1S/C40H30N8O/c41-23-34(38(36(25-43)26-44)30-9-3-1-4-10-30)15-7-13-32-17-18-33(40(32)48-21-19-47(29-49)20-22-48)14-8-16-35(24-42)39(37(27-45)28-46)31-11-5-2-6-12-31/h1-16,29,36H,17-22H2/b14-8+,15-7+,32-13+,35-16+,38-34- |
| InChIKey | HLDCMEGHXLHCKE-HHFZIMOLSA-N |
| XLogP | 6.44 |
| TPSA | 166.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.74 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|