C31H36N6O2 — CID 142970649
ethyl 4-[(5E)-2-[(1E,3Z,5E)-6-amino-4,6-dicyano-5-phenylhexa-1,3,5-trienyl]-5-(4-aminopent-4-enylidene)cyclopenten-1-yl]piperazine-1-carboxylate (PubChem CID 142970649) has the molecular formula C31H36N6O2 and a molecular weight of 524.67 g/mol. Its IUPAC name is ethyl 4-[(5E)-2-[(1E,3Z,5E)-6-amino-4,6-dicyano-5-phenylhexa-1,3,5-trienyl]-5-(4-aminopent-4-enylidene)cyclopenten-1-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(5E)-2-[(1E,3Z,5E)-6-amino-4,6-dicyano-5-phenylhexa-1,3,5-trienyl]-5-(4-aminopent-4-enylidene)cyclopenten-1-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 142970649 |
| Molecular Formula | C31H36N6O2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | ethyl 4-[(5E)-2-[(1E,3Z,5E)-6-amino-4,6-dicyano-5-phenylhexa-1,3,5-trienyl]-5-(4-aminopent-4-enylidene)cyclopenten-1-yl]piperazine-1-carboxylate |
| SMILES | C=C(N)CC/C=C1\CCC(/C=C/C=C(C#N)/C(=C(/N)C#N)c2ccccc2)=C1N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C31H36N6O2/c1-3-39-31(38)37-19-17-36(18-20-37)30-25(12-7-9-23(2)34)15-16-26(30)13-8-14-27(21-32)29(28(35)22-33)24-10-5-4-6-11-24/h4-6,8,10-14H,2-3,7,9,15-20,34-35H2,1H3/b13-8+,25-12+,27-14+,29-28+ |
| InChIKey | RGAVGFDDUQIJOB-NVBKOKMRSA-N |
| XLogP | 4.89 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|