C29H14N6O4 — CID 59038799
4-[(3Z,7Z)-9-(4-carboxyphenyl)-2,4,8-tricyano-1-imino-10,10-diisocyanodeca-1,3,5,7,9-pentaen-3-yl]benzoic acid (PubChem CID 59038799) has the molecular formula C29H14N6O4 and a molecular weight of 510.47 g/mol. Its IUPAC name is 4-[(3Z,7Z)-9-(4-carboxyphenyl)-2,4,8-tricyano-1-imino-10,10-diisocyanodeca-1,3,5,7,9-pentaen-3-yl]benzoic acid.
| Compound Name | 4-[(3Z,7Z)-9-(4-carboxyphenyl)-2,4,8-tricyano-1-imino-10,10-diisocyanodeca-1,3,5,7,9-pentaen-3-yl]benzoic acid |
|---|---|
| PubChem CID | 59038799 |
| Molecular Formula | C29H14N6O4 |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 4-[(3Z,7Z)-9-(4-carboxyphenyl)-2,4,8-tricyano-1-imino-10,10-diisocyanodeca-1,3,5,7,9-pentaen-3-yl]benzoic acid |
| SMILES | [C-]#[N+]C([N+]#[C-])=C(/C(C#N)=C/C=C/C(C#N)=C(/C(=C=N)C#N)c1ccc(C(=O)O)cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H14N6O4/c1-34-27(35-2)26(19-8-12-21(13-9-19)29(38)39)23(15-31)5-3-4-22(14-30)25(24(16-32)17-33)18-6-10-20(11-7-18)28(36)37/h3-13,32H,(H,36,37)(H,38,39)/b4-3?,23-5+,25-22- |
| InChIKey | DXIAFYMBDWCSSS-XYUOFPALSA-N |
| XLogP | 5.27 |
| TPSA | 178.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|