C13H4N6 — CID 5236546
8-iminoocta-1,3,5,7-tetraene-1,1,2,6,7-pentacarbonitrile (PubChem CID 5236546) has the molecular formula C13H4N6 and a molecular weight of 244.22 g/mol. Its IUPAC name is 8-iminoocta-1,3,5,7-tetraene-1,1,2,6,7-pentacarbonitrile.
| Compound Name | 8-iminoocta-1,3,5,7-tetraene-1,1,2,6,7-pentacarbonitrile |
|---|---|
| PubChem CID | 5236546 |
| Molecular Formula | C13H4N6 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 8-iminoocta-1,3,5,7-tetraene-1,1,2,6,7-pentacarbonitrile |
| SMILES | N#CC(=C=N)C(C#N)=CC=CC(C#N)=C(C#N)C#N |
| InChI | InChI=1S/C13H4N6/c14-4-10(12(6-16)7-17)2-1-3-11(5-15)13(8-18)9-19/h1-3,16H |
| InChIKey | MZIGWKMQAZHEOF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 142.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|