C15H12N6 — CID 72512163
2-cyano-8-(iminomethylidene)-N,N'-dimethylnona-2,4,6-trienediimidoyl dicyanide (PubChem CID 72512163) has the molecular formula C15H12N6 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-cyano-8-(iminomethylidene)-N,N'-dimethylnona-2,4,6-trienediimidoyl dicyanide.
| Compound Name | 2-cyano-8-(iminomethylidene)-N,N'-dimethylnona-2,4,6-trienediimidoyl dicyanide |
|---|---|
| PubChem CID | 72512163 |
| Molecular Formula | C15H12N6 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-cyano-8-(iminomethylidene)-N,N'-dimethylnona-2,4,6-trienediimidoyl dicyanide |
| SMILES | C/N=C(\C#N)C(=C=N)C=CC=CC=C(C#N)/C(C#N)=N/C |
| InChI | InChI=1S/C15H12N6/c1-20-14(10-18)12(8-16)6-4-3-5-7-13(9-17)15(11-19)21-2/h3-7,16H,1-2H3/b5-3?,6-4?,13-7?,20-14+,21-15+ |
| InChIKey | UGOGGAWNCSGGCD-YUAGXCPGSA-N |
| XLogP | 1.91 |
| TPSA | 119.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|