C16H15N3O6 — CID 136734092
dimethyl 2-cyano-4-[(1R)-1-cyano-3-methoxy-3-oxopropyl]-6-(iminomethylidene)hepta-2,4-dienedioate (PubChem CID 136734092) has the molecular formula C16H15N3O6 and a molecular weight of 345.31 g/mol. Its IUPAC name is dimethyl 2-cyano-4-[(1R)-1-cyano-3-methoxy-3-oxopropyl]-6-(iminomethylidene)hepta-2,4-dienedioate.
| Compound Name | dimethyl 2-cyano-4-[(1R)-1-cyano-3-methoxy-3-oxopropyl]-6-(iminomethylidene)hepta-2,4-dienedioate |
|---|---|
| PubChem CID | 136734092 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | dimethyl 2-cyano-4-[(1R)-1-cyano-3-methoxy-3-oxopropyl]-6-(iminomethylidene)hepta-2,4-dienedioate |
| SMILES | COC(=O)C[C@@H](C#N)C(C=C(C#N)C(=O)OC)=CC(=C=N)C(=O)OC |
| InChI | InChI=1S/C16H15N3O6/c1-23-14(20)6-11(7-17)10(4-12(8-18)15(21)24-2)5-13(9-19)16(22)25-3/h4-5,11,18H,6H2,1-3H3/t11-/m0/s1 |
| InChIKey | UOUZZJIAWFHYEJ-NSHDSACASA-N |
| XLogP | 0.59 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|