C8H13N3 — CID 153364034
(2Z)-2-(aminomethylidene)-N,3-dimethylbutanimidoyl cyanide (PubChem CID 153364034) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is (2Z)-2-(aminomethylidene)-N,3-dimethylbutanimidoyl cyanide.
| Compound Name | (2Z)-2-(aminomethylidene)-N,3-dimethylbutanimidoyl cyanide |
|---|---|
| PubChem CID | 153364034 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (2Z)-2-(aminomethylidene)-N,3-dimethylbutanimidoyl cyanide |
| SMILES | C/N=C(C#N)/C(=C\N)C(C)C |
| InChI | InChI=1S/C8H13N3/c1-6(2)7(4-9)8(5-10)11-3/h4,6H,9H2,1-3H3/b7-4-,11-8+ |
| InChIKey | YWKKXGYUQLETBS-AFDHTILLSA-N |
| XLogP | 1.08 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|