C10H15N — CID 176677129
(2E,4Z)-2-methyl-4-propan-2-ylhexa-2,4-dienenitrile (PubChem CID 176677129) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (2E,4Z)-2-methyl-4-propan-2-ylhexa-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2-methyl-4-propan-2-ylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 176677129 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (2E,4Z)-2-methyl-4-propan-2-ylhexa-2,4-dienenitrile |
| SMILES | C/C=C(\C=C(/C)C#N)C(C)C |
| InChI | InChI=1S/C10H15N/c1-5-10(8(2)3)6-9(4)7-11/h5-6,8H,1-4H3/b9-6+,10-5+ |
| InChIKey | DWQUFKNCCHOAIS-TXFIJWAUSA-N |
| XLogP | 3.06 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|