C8H16N2 — CID 174306198
2,4-dimethyl-3-methyliminopent-1-en-1-amine (PubChem CID 174306198) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,4-dimethyl-3-methyliminopent-1-en-1-amine.
| Compound Name | 2,4-dimethyl-3-methyliminopent-1-en-1-amine |
|---|---|
| PubChem CID | 174306198 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 2,4-dimethyl-3-methyliminopent-1-en-1-amine |
| SMILES | C/N=C(/C(C)=CN)C(C)C |
| InChI | InChI=1S/C8H16N2/c1-6(2)8(10-4)7(3)5-9/h5-6H,9H2,1-4H3/b7-5?,10-8+ |
| InChIKey | LNNOTRBBZSYCCA-QSKBLMOKSA-N |
| XLogP | 1.58 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|