C12H20N2 — CID 178050407
(3Z,5Z)-4-(N-methyl-C-propan-2-ylcarbonimidoyl)hepta-1,3,5-trien-3-amine (PubChem CID 178050407) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (3Z,5Z)-4-(N-methyl-C-propan-2-ylcarbonimidoyl)hepta-1,3,5-trien-3-amine.
| Compound Name | (3Z,5Z)-4-(N-methyl-C-propan-2-ylcarbonimidoyl)hepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 178050407 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (3Z,5Z)-4-(N-methyl-C-propan-2-ylcarbonimidoyl)hepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(N)=C(\C=C/C)C(=N/C)/C(C)C |
| InChI | InChI=1S/C12H20N2/c1-6-8-10(11(13)7-2)12(14-5)9(3)4/h6-9H,2,13H2,1,3-5H3/b8-6-,11-10-,14-12+ |
| InChIKey | DMGVSELVXNEIHR-NEPWTDQSSA-N |
| XLogP | 2.69 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|