C10H19N5O — CID 142467987
(2Z)-3-amino-N'-[amino(2-hydroxyethyl)amino]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide (PubChem CID 142467987) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is (2Z)-3-amino-N'-[amino(2-hydroxyethyl)amino]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide.
| Compound Name | (2Z)-3-amino-N'-[amino(2-hydroxyethyl)amino]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 142467987 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | (2Z)-3-amino-N'-[amino(2-hydroxyethyl)amino]-2-[(Z)-prop-1-enyl]penta-2,4-dienimidamide |
| SMILES | C=C/C(N)=C(\C=C/C)C(/N)=N/N(N)CCO |
| InChI | InChI=1S/C10H19N5O/c1-3-5-8(9(11)4-2)10(12)14-15(13)6-7-16/h3-5,16H,2,6-7,11,13H2,1H3,(H2,12,14)/b5-3-,9-8- |
| InChIKey | FQRYOLVQIXECAZ-MLBMHQFOSA-N |
| XLogP | -0.60 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|