C13H21N3 — CID 126676681
(2E,5Z,6Z)-2-amino-3-ethenyl-5-ethylidene-N'-methylocta-2,6-dienimidamide (PubChem CID 126676681) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is (2E,5Z,6Z)-2-amino-3-ethenyl-5-ethylidene-N'-methylocta-2,6-dienimidamide.
| Compound Name | (2E,5Z,6Z)-2-amino-3-ethenyl-5-ethylidene-N'-methylocta-2,6-dienimidamide |
|---|---|
| PubChem CID | 126676681 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | (2E,5Z,6Z)-2-amino-3-ethenyl-5-ethylidene-N'-methylocta-2,6-dienimidamide |
| SMILES | C=C/C(CC(/C=C\C)=C/C)=C(N)\C(N)=N\C |
| InChI | InChI=1S/C13H21N3/c1-5-8-10(6-2)9-11(7-3)12(14)13(15)16-4/h5-8H,3,9,14H2,1-2,4H3,(H2,15,16)/b8-5-,10-6+,12-11- |
| InChIKey | AECHIJDSQJNXCH-NSBDQXEGSA-N |
| XLogP | 2.28 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|