C7H13N3 — CID 130341577
N-[(1E,3E)-2-aminopenta-1,3-dienyl]-N'-methylmethanimidamide (PubChem CID 130341577) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is N-[(1E,3E)-2-aminopenta-1,3-dienyl]-N'-methylmethanimidamide.
| Compound Name | N-[(1E,3E)-2-aminopenta-1,3-dienyl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 130341577 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | N-[(1E,3E)-2-aminopenta-1,3-dienyl]-N'-methylmethanimidamide |
| SMILES | C/C=C/C(N)=C\N/C=N/C |
| InChI | InChI=1S/C7H13N3/c1-3-4-7(8)5-10-6-9-2/h3-6H,8H2,1-2H3,(H,9,10)/b4-3+,7-5+ |
| InChIKey | PNTWUOKZDRBYHB-BDWKERMESA-N |
| XLogP | 0.61 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|