C4H9N3 — CID 144748232
N-(1-aminoethenyl)-N'-methylmethanimidamide (PubChem CID 144748232) has the molecular formula C4H9N3 and a molecular weight of 99.14 g/mol. Its IUPAC name is N-(1-aminoethenyl)-N'-methylmethanimidamide.
| Compound Name | N-(1-aminoethenyl)-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 144748232 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | N-(1-aminoethenyl)-N'-methylmethanimidamide |
| SMILES | C=C(N)N/C=N/C |
| InChI | InChI=1S/C4H9N3/c1-4(5)7-3-6-2/h3H,1,5H2,2H3,(H,6,7) |
| InChIKey | ZVMAPLCDIZCPQI-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|