C15H33N3 — CID 143349853
ethane;N-[(2E)-3-(ethylideneamino)penta-2,4-dien-2-yl]-N'-methylmethanimidamide (PubChem CID 143349853) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is ethane;N-[(2E)-3-(ethylideneamino)penta-2,4-dien-2-yl]-N'-methylmethanimidamide.
| Compound Name | ethane;N-[(2E)-3-(ethylideneamino)penta-2,4-dien-2-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 143349853 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | ethane;N-[(2E)-3-(ethylideneamino)penta-2,4-dien-2-yl]-N'-methylmethanimidamide |
| SMILES | C=CC(/N=C/C)=C(/C)N/C=N/C.CC.CC.CC |
| InChI | InChI=1S/C9H15N3.3C2H6/c1-5-9(11-6-2)8(3)12-7-10-4;3*1-2/h5-7H,1H2,2-4H3,(H,10,12);3*1-2H3/b9-8+,11-6+;;; |
| InChIKey | ZZBWKBBJCFLGKC-DHINQTCASA-N |
| XLogP | 4.82 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|