C12H23N — CID 143978503
ethane;N-[(4Z)-2-methylhepta-1,4-dien-4-yl]ethanimine (PubChem CID 143978503) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is ethane;N-[(4Z)-2-methylhepta-1,4-dien-4-yl]ethanimine.
| Compound Name | ethane;N-[(4Z)-2-methylhepta-1,4-dien-4-yl]ethanimine |
|---|---|
| PubChem CID | 143978503 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | ethane;N-[(4Z)-2-methylhepta-1,4-dien-4-yl]ethanimine |
| SMILES | C=C(C)CC(=C/CC)/N=C/C.CC |
| InChI | InChI=1S/C10H17N.C2H6/c1-5-7-10(11-6-2)8-9(3)4;1-2/h6-7H,3,5,8H2,1-2,4H3;1-2H3/b10-7-,11-6+; |
| InChIKey | FBIXVJRDMIORPX-FNIBXIKSSA-N |
| XLogP | 4.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|