C8H14N2 — CID 142082963
(2Z)-2-(ethylideneamino)-4-methylpenta-2,4-dien-1-amine (PubChem CID 142082963) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (2Z)-2-(ethylideneamino)-4-methylpenta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-(ethylideneamino)-4-methylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142082963 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (2Z)-2-(ethylideneamino)-4-methylpenta-2,4-dien-1-amine |
| SMILES | C=C(C)/C=C(CN)\N=C\C |
| InChI | InChI=1S/C8H14N2/c1-4-10-8(6-9)5-7(2)3/h4-5H,2,6,9H2,1,3H3/b8-5-,10-4+ |
| InChIKey | PXJIHRVAGUFKMD-VRCTZXRLSA-N |
| XLogP | 1.50 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|