C10H15N — CID 146259127
N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]ethanimine (PubChem CID 146259127) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]ethanimine.
| Compound Name | N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]ethanimine |
|---|---|
| PubChem CID | 146259127 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]ethanimine |
| SMILES | C=C/C=C(C)\C(=C/C)\N=C\C |
| InChI | InChI=1S/C10H15N/c1-5-8-9(4)10(6-2)11-7-3/h5-8H,1H2,2-4H3/b9-8-,10-6+,11-7+ |
| InChIKey | ZMRLZFXAYLXNPQ-BTIBOPHBSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|