C10H14N2 — CID 166800420
(3E,5Z)-5-methyl-N-(methylideneamino)octa-1,3,5,7-tetraen-4-amine (PubChem CID 166800420) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is (3E,5Z)-5-methyl-N-(methylideneamino)octa-1,3,5,7-tetraen-4-amine.
| Compound Name | (3E,5Z)-5-methyl-N-(methylideneamino)octa-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 166800420 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | (3E,5Z)-5-methyl-N-(methylideneamino)octa-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C(C)\C(=C/C=C)NN=C |
| InChI | InChI=1S/C10H14N2/c1-5-7-9(3)10(8-6-2)12-11-4/h5-8,12H,1-2,4H2,3H3/b9-7-,10-8+ |
| InChIKey | JTGGOOPHFSCPBE-FKJILZIQSA-N |
| XLogP | 2.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|