C13H21NO — CID 142174793
2,2-dimethyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]propanamide (PubChem CID 142174793) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]propanamide |
|---|---|
| PubChem CID | 142174793 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 2,2-dimethyl-N-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]propanamide |
| SMILES | C=C/C=C(C)\C(=C/C)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H21NO/c1-7-9-10(3)11(8-2)14-12(15)13(4,5)6/h7-9H,1H2,2-6H3,(H,14,15)/b10-9-,11-8+ |
| InChIKey | QBPPUTHWZIWBIV-LMMFKTOUSA-N |
| XLogP | 3.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|