C14H18ClNO — CID 154932182
(2E)-N-[(1E,3E,5Z)-4-chloro-5-methylhepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide (PubChem CID 154932182) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is (2E)-N-[(1E,3E,5Z)-4-chloro-5-methylhepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide.
| Compound Name | (2E)-N-[(1E,3E,5Z)-4-chloro-5-methylhepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 154932182 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (2E)-N-[(1E,3E,5Z)-4-chloro-5-methylhepta-1,3,5-trienyl]-2-methylpenta-2,4-dienamide |
| SMILES | C=C/C=C(\C)C(=O)N/C=C/C=C(Cl)\C(C)=C/C |
| InChI | InChI=1S/C14H18ClNO/c1-5-8-12(4)14(17)16-10-7-9-13(15)11(3)6-2/h5-10H,1H2,2-4H3,(H,16,17)/b10-7+,11-6-,12-8+,13-9+ |
| InChIKey | YYBZJPXTEHNXIL-MDKOYWCVSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|