C12H25N3O — CID 177229966
N-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2,2-dimethylpropanamide;ethane (PubChem CID 177229966) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2,2-dimethylpropanamide;ethane.
| Compound Name | N-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2,2-dimethylpropanamide;ethane |
|---|---|
| PubChem CID | 177229966 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | N-[(E)-N-(dimethylamino)-C-ethenylcarbonimidoyl]-2,2-dimethylpropanamide;ethane |
| SMILES | C=C/C(=N\N(C)C)NC(=O)C(C)(C)C.CC |
| InChI | InChI=1S/C10H19N3O.C2H6/c1-7-8(12-13(5)6)11-9(14)10(2,3)4;1-2/h7H,1H2,2-6H3,(H,11,12,14);1-2H3 |
| InChIKey | NSYDCMWWGRRTNI-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|