C5H9ClN2 — CID 166849863
(1E)-N,N-dimethylprop-2-enehydrazonoyl chloride (PubChem CID 166849863) has the molecular formula C5H9ClN2 and a molecular weight of 132.59 g/mol. Its IUPAC name is (1E)-N,N-dimethylprop-2-enehydrazonoyl chloride.
| Compound Name | (1E)-N,N-dimethylprop-2-enehydrazonoyl chloride |
|---|---|
| PubChem CID | 166849863 |
| Molecular Formula | C5H9ClN2 |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | (1E)-N,N-dimethylprop-2-enehydrazonoyl chloride |
| SMILES | C=C/C(Cl)=N\N(C)C |
| InChI | InChI=1S/C5H9ClN2/c1-4-5(6)7-8(2)3/h4H,1H2,2-3H3/b7-5+ |
| InChIKey | JIPRTUSPGUPJRG-FNORWQNLSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|