C13H22ClN — CID 176946287
(3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine;ethane (PubChem CID 176946287) has the molecular formula C13H22ClN and a molecular weight of 227.78 g/mol. Its IUPAC name is (3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine;ethane.
| Compound Name | (3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine;ethane |
|---|---|
| PubChem CID | 176946287 |
| Molecular Formula | C13H22ClN |
| Molecular Weight | 227.78 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | (3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine;ethane |
| SMILES | C=C/C(C)=C(\C(=C)Cl)N(C)C(=C)C.CC |
| InChI | InChI=1S/C11H16ClN.C2H6/c1-7-9(4)11(10(5)12)13(6)8(2)3;1-2/h7H,1-2,5H2,3-4,6H3;1-2H3/b11-9+; |
| InChIKey | OCYJONNDCCRMNT-LBEJWNQZSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.78 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|