C11H16ClN — CID 176946288
(3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine (PubChem CID 176946288) has the molecular formula C11H16ClN and a molecular weight of 197.71 g/mol. Its IUPAC name is (3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine.
| Compound Name | (3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 176946288 |
| Molecular Formula | C11H16ClN |
| Molecular Weight | 197.71 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | (3E)-2-chloro-N,4-dimethyl-N-prop-1-en-2-ylhexa-1,3,5-trien-3-amine |
| SMILES | C=C/C(C)=C(\C(=C)Cl)N(C)C(=C)C |
| InChI | InChI=1S/C11H16ClN/c1-7-9(4)11(10(5)12)13(6)8(2)3/h7H,1-2,5H2,3-4,6H3/b11-9+ |
| InChIKey | FCRFCGUUHABUPA-PKNBQFBNSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.71 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|