C8H19N3 — CID 143791627
methanamine;(1E)-1-N',1-N',2-trimethylbuta-1,3-diene-1,1-diamine (PubChem CID 143791627) has the molecular formula C8H19N3 and a molecular weight of 157.26 g/mol. Its IUPAC name is methanamine;(1E)-1-N',1-N',2-trimethylbuta-1,3-diene-1,1-diamine.
| Compound Name | methanamine;(1E)-1-N',1-N',2-trimethylbuta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 143791627 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | methanamine;(1E)-1-N',1-N',2-trimethylbuta-1,3-diene-1,1-diamine |
| SMILES | C=C/C(C)=C(\N)N(C)C.CN |
| InChI | InChI=1S/C7H14N2.CH5N/c1-5-6(2)7(8)9(3)4;1-2/h5H,1,8H2,2-4H3;2H2,1H3/b7-6+; |
| InChIKey | DFVZWBAPMNFMHR-UHDJGPCESA-N |
| XLogP | 0.50 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|