C9H17N3 — CID 170009667
(Z)-N'-[(Z)-but-3-en-2-ylideneamino]-N,N,N'-trimethylethene-1,2-diamine (PubChem CID 170009667) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is (Z)-N'-[(Z)-but-3-en-2-ylideneamino]-N,N,N'-trimethylethene-1,2-diamine.
| Compound Name | (Z)-N'-[(Z)-but-3-en-2-ylideneamino]-N,N,N'-trimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 170009667 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (Z)-N'-[(Z)-but-3-en-2-ylideneamino]-N,N,N'-trimethylethene-1,2-diamine |
| SMILES | C=C/C(C)=N\N(C)/C=C\N(C)C |
| InChI | InChI=1S/C9H17N3/c1-6-9(2)10-12(5)8-7-11(3)4/h6-8H,1H2,2-5H3/b8-7-,10-9- |
| InChIKey | FVNXJVYJGNBBKB-QRLRYFCNSA-N |
| XLogP | 1.51 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|