About N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane
N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane (PubChem CID 142586154) has the molecular formula C9H22N2
and a molecular weight of 158.29 g/mol. Its IUPAC name is N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane.
Molecular Properties
| Compound Name | N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane |
| PubChem CID | 142586154 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane |
| SMILES | C=C/C(C)=N\NC.CC.CC |
| InChI | InChI=1S/C5H10N2.2C2H6/c1-4-5(2)7-6-3;2*1-2/h4,6H,1H2,2-3H3;2*1-2H3/b7-5-;; |
| InChIKey | LWKHLQRIVOHPEC-MWKZNRQPSA-N |
| XLogP | 2.82 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane?
The IUPAC name of N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane (CID 142586154) is N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane.
What is the SMILES notation for N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane?
The canonical SMILES for N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane is C=C/C(C)=N\NC.CC.CC.
What is the InChIKey of N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane?
The InChIKey is LWKHLQRIVOHPEC-MWKZNRQPSA-N. The full InChI is InChI=1S/C5H10N2.2C2H6/c1-4-5(2)7-6-3;2*1-2/h4,6H,1H2,2-3H3;2*1-2H3/b7-5-;;.
What are the key properties of N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane?
N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane has a molecular weight of 158.29 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-but-3-en-2-ylideneamino]methanamine;ethane is sourced from PubChem (CID 142586154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).