About N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane
N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane (PubChem CID 143657698) has the molecular formula C8H15N3
and a molecular weight of 153.23 g/mol. Its IUPAC name is N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane.
Molecular Properties
| Compound Name | N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane |
| PubChem CID | 143657698 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane |
| SMILES | C=C/C(C)=N\N=C/N=C.CC |
| InChI | InChI=1S/C6H9N3.C2H6/c1-4-6(2)9-8-5-7-3;1-2/h4-5H,1,3H2,2H3;1-2H3/b8-5-,9-6-; |
| InChIKey | KHDCBJNMQRXYOB-CFPLPEBESA-N |
| XLogP | 2.30 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane?
The IUPAC name of N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane (CID 143657698) is N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane.
What is the SMILES notation for N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane?
The canonical SMILES for N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane is C=C/C(C)=N\N=C/N=C.CC.
What is the InChIKey of N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane?
The InChIKey is KHDCBJNMQRXYOB-CFPLPEBESA-N. The full InChI is InChI=1S/C6H9N3.C2H6/c1-4-6(2)9-8-5-7-3;1-2/h4-5H,1,3H2,2H3;1-2H3/b8-5-,9-6-;.
What are the key properties of N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane?
N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane has a molecular weight of 153.23 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-but-3-en-2-ylideneamino]-N-methylidenemethanimidamide;ethane is sourced from PubChem (CID 143657698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).