C11H19N — CID 143665734
ethane;(3E)-N-ethenyl-2-methylhexa-1,3,5-trien-3-amine (PubChem CID 143665734) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is ethane;(3E)-N-ethenyl-2-methylhexa-1,3,5-trien-3-amine.
| Compound Name | ethane;(3E)-N-ethenyl-2-methylhexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143665734 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | ethane;(3E)-N-ethenyl-2-methylhexa-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(/NC=C)C(=C)C.CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-5-7-9(8(3)4)10-6-2;1-2/h5-7,10H,1-3H2,4H3;1-2H3/b9-7+; |
| InChIKey | LABVBNOLSXPUQL-BXTVWIJMSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|