C15H19N — CID 144989902
2,6-dimethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline (PubChem CID 144989902) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline.
| Compound Name | 2,6-dimethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline |
|---|---|
| PubChem CID | 144989902 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,6-dimethyl-N-[(3E)-2-methylhexa-1,3,5-trien-3-yl]aniline |
| SMILES | C=C/C=C(/Nc1c(C)cccc1C)C(=C)C |
| InChI | InChI=1S/C15H19N/c1-6-8-14(11(2)3)16-15-12(4)9-7-10-13(15)5/h6-10,16H,1-2H2,3-5H3/b14-8+ |
| InChIKey | AXJBVAKUJHGVJF-RIYZIHGNSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|