C14H22N2 — CID 15846259
N'-tert-butyl-N-(2,6-dimethylphenyl)ethanimidamide (PubChem CID 15846259) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N'-tert-butyl-N-(2,6-dimethylphenyl)ethanimidamide.
| Compound Name | N'-tert-butyl-N-(2,6-dimethylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 15846259 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N'-tert-butyl-N-(2,6-dimethylphenyl)ethanimidamide |
| SMILES | C/C(=N\C(C)(C)C)Nc1c(C)cccc1C |
| InChI | InChI=1S/C14H22N2/c1-10-8-7-9-11(2)13(10)15-12(3)16-14(4,5)6/h7-9H,1-6H3,(H,15,16) |
| InChIKey | WAQYSJCMLLAEKY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|