C15H24N2O — CID 65264581
3-amino-N-(2,6-dimethylphenyl)-2,2,3-trimethylbutanamide (PubChem CID 65264581) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-amino-N-(2,6-dimethylphenyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(2,6-dimethylphenyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65264581 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-amino-N-(2,6-dimethylphenyl)-2,2,3-trimethylbutanamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C15H24N2O/c1-10-8-7-9-11(2)12(10)17-13(18)14(3,4)15(5,6)16/h7-9H,16H2,1-6H3,(H,17,18) |
| InChIKey | WMJBISHQMWKZOC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |