C13H18N2O2 — CID 5108045
N-(2,6-dimethylphenyl)-2-formamido-2-methylpropanamide (PubChem CID 5108045) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-formamido-2-methylpropanamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-formamido-2-methylpropanamide |
|---|---|
| PubChem CID | 5108045 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-formamido-2-methylpropanamide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C)(C)NC=O |
| InChI | InChI=1S/C13H18N2O2/c1-9-6-5-7-10(2)11(9)15-12(17)13(3,4)14-8-16/h5-8H,1-4H3,(H,14,16)(H,15,17) |
| InChIKey | IMCWIOSFFQMCSR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|