C13H18F2N2O — CID 126818541
1-(3,3-difluorobutan-2-yl)-3-(2,6-dimethylphenyl)urea (PubChem CID 126818541) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-(3,3-difluorobutan-2-yl)-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-(3,3-difluorobutan-2-yl)-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 126818541 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(3,3-difluorobutan-2-yl)-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)NC(C)C(C)(F)F |
| InChI | InChI=1S/C13H18F2N2O/c1-8-6-5-7-9(2)11(8)17-12(18)16-10(3)13(4,14)15/h5-7,10H,1-4H3,(H2,16,17,18) |
| InChIKey | VZLYGKONHWSFOS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |