C13H17Cl3N2O — CID 65264588
3-amino-2,2,3-trimethyl-N-(2,4,6-trichlorophenyl)butanamide (PubChem CID 65264588) has the molecular formula C13H17Cl3N2O and a molecular weight of 323.65 g/mol. Its IUPAC name is 3-amino-2,2,3-trimethyl-N-(2,4,6-trichlorophenyl)butanamide.
| Compound Name | 3-amino-2,2,3-trimethyl-N-(2,4,6-trichlorophenyl)butanamide |
|---|---|
| PubChem CID | 65264588 |
| Molecular Formula | C13H17Cl3N2O |
| Molecular Weight | 323.65 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 3-amino-2,2,3-trimethyl-N-(2,4,6-trichlorophenyl)butanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl3N2O/c1-12(2,13(3,4)17)11(19)18-10-8(15)5-7(14)6-9(10)16/h5-6H,17H2,1-4H3,(H,18,19) |
| InChIKey | LDWXTVPSHVIMSY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |