C15H21ClN2O3 — CID 65264248
methyl 2-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-chlorobenzoate (PubChem CID 65264248) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is methyl 2-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-chlorobenzoate.
| Compound Name | methyl 2-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 65264248 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl 2-[(3-amino-2,2,3-trimethylbutanoyl)amino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C15H21ClN2O3/c1-14(2,15(3,4)17)13(20)18-11-8-9(16)6-7-10(11)12(19)21-5/h6-8H,17H2,1-5H3,(H,18,20) |
| InChIKey | SFKLKUPYIFNTBD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |