C12H10ClN3O3S — CID 62787676
methyl 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-chlorobenzoate (PubChem CID 62787676) has the molecular formula C12H10ClN3O3S and a molecular weight of 311.75 g/mol. Its IUPAC name is methyl 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-chlorobenzoate.
| Compound Name | methyl 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-chlorobenzoate |
|---|---|
| PubChem CID | 62787676 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | methyl 2-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C12H10ClN3O3S/c1-19-11(18)7-3-2-6(13)4-8(7)15-10(17)9-5-20-12(14)16-9/h2-5H,1H3,(H2,14,16)(H,15,17) |
| InChIKey | BSMAZFIVKJVMGP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |