C12H11N3O4S — CID 63744459
3-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-methoxybenzoic acid (PubChem CID 63744459) has the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. Its IUPAC name is 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-methoxybenzoic acid.
| Compound Name | 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 63744459 |
| Molecular Formula | C12H11N3O4S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 3-[(2-amino-1,3-thiazole-4-carbonyl)amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)c1csc(N)n1 |
| InChI | InChI=1S/C12H11N3O4S/c1-19-9-3-2-6(11(17)18)4-7(9)14-10(16)8-5-20-12(13)15-8/h2-5H,1H3,(H2,13,15)(H,14,16)(H,17,18) |
| InChIKey | ZVQRTWLJHGGGBW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |