C13H18BrFN2O — CID 107599820
3-amino-N-(2-bromo-6-fluorophenyl)-2,2,3-trimethylbutanamide (PubChem CID 107599820) has the molecular formula C13H18BrFN2O and a molecular weight of 317.20 g/mol. Its IUPAC name is 3-amino-N-(2-bromo-6-fluorophenyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(2-bromo-6-fluorophenyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 107599820 |
| Molecular Formula | C13H18BrFN2O |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 3-amino-N-(2-bromo-6-fluorophenyl)-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)Nc1c(F)cccc1Br |
| InChI | InChI=1S/C13H18BrFN2O/c1-12(2,13(3,4)16)11(18)17-10-8(14)6-5-7-9(10)15/h5-7H,16H2,1-4H3,(H,17,18) |
| InChIKey | DSEWACXONAOTIK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |