C11H14BrFN2O — CID 107599929
3-amino-N-(2-bromo-6-fluorophenyl)-3-methylbutanamide (PubChem CID 107599929) has the molecular formula C11H14BrFN2O and a molecular weight of 289.15 g/mol. Its IUPAC name is 3-amino-N-(2-bromo-6-fluorophenyl)-3-methylbutanamide.
| Compound Name | 3-amino-N-(2-bromo-6-fluorophenyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 107599929 |
| Molecular Formula | C11H14BrFN2O |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-amino-N-(2-bromo-6-fluorophenyl)-3-methylbutanamide |
| SMILES | CC(C)(N)CC(=O)Nc1c(F)cccc1Br |
| InChI | InChI=1S/C11H14BrFN2O/c1-11(2,14)6-9(16)15-10-7(12)4-3-5-8(10)13/h3-5H,6,14H2,1-2H3,(H,15,16) |
| InChIKey | FPXRBNHLAMVJID-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |