C26H36N4 — CID 102298360
N'-[(1R,2R)-2-[1-(2,6-dimethylanilino)ethylideneamino]cyclohexyl]-N-(2,6-dimethylphenyl)ethanimidamide (PubChem CID 102298360) has the molecular formula C26H36N4 and a molecular weight of 404.60 g/mol. Its IUPAC name is N'-[(1R,2R)-2-[1-(2,6-dimethylanilino)ethylideneamino]cyclohexyl]-N-(2,6-dimethylphenyl)ethanimidamide.
| Compound Name | N'-[(1R,2R)-2-[1-(2,6-dimethylanilino)ethylideneamino]cyclohexyl]-N-(2,6-dimethylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 102298360 |
| Molecular Formula | C26H36N4 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | N'-[(1R,2R)-2-[1-(2,6-dimethylanilino)ethylideneamino]cyclohexyl]-N-(2,6-dimethylphenyl)ethanimidamide |
| SMILES | C/C(=N/[C@@H]1CCCC[C@H]1/N=C(\C)Nc1c(C)cccc1C)Nc1c(C)cccc1C |
| InChI | InChI=1S/C26H36N4/c1-17-11-9-12-18(2)25(17)29-21(5)27-23-15-7-8-16-24(23)28-22(6)30-26-19(3)13-10-14-20(26)4/h9-14,23-24H,7-8,15-16H2,1-6H3,(H,27,29)(H,28,30)/t23-,24-/m1/s1 |
| InChIKey | BPRBRAZRGQQVRU-DNQXCXABSA-N |
| XLogP | 6.59 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|