C15H23N5 — CID 88752390
(1E)-1-[amino-(2,6-dimethylanilino)methylidene]-2-cyclopentylguanidine (PubChem CID 88752390) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is (1E)-1-[amino-(2,6-dimethylanilino)methylidene]-2-cyclopentylguanidine.
| Compound Name | (1E)-1-[amino-(2,6-dimethylanilino)methylidene]-2-cyclopentylguanidine |
|---|---|
| PubChem CID | 88752390 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | (1E)-1-[amino-(2,6-dimethylanilino)methylidene]-2-cyclopentylguanidine |
| SMILES | Cc1cccc(C)c1N/C(N)=N/C(N)=N/C1CCCC1 |
| InChI | InChI=1S/C15H23N5/c1-10-6-5-7-11(2)13(10)19-15(17)20-14(16)18-12-8-3-4-9-12/h5-7,12H,3-4,8-9H2,1-2H3,(H5,16,17,18,19,20) |
| InChIKey | JKHYAXYYYWOQMD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|