C11H17N5O — CID 88751377
(1E)-1-[amino-(2-methoxy-6-methylanilino)methylidene]-2-methylguanidine (PubChem CID 88751377) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is (1E)-1-[amino-(2-methoxy-6-methylanilino)methylidene]-2-methylguanidine.
| Compound Name | (1E)-1-[amino-(2-methoxy-6-methylanilino)methylidene]-2-methylguanidine |
|---|---|
| PubChem CID | 88751377 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (1E)-1-[amino-(2-methoxy-6-methylanilino)methylidene]-2-methylguanidine |
| SMILES | C/N=C(N)/N=C(\N)Nc1c(C)cccc1OC |
| InChI | InChI=1S/C11H17N5O/c1-7-5-4-6-8(17-3)9(7)15-11(13)16-10(12)14-2/h4-6H,1-3H3,(H5,12,13,14,15,16) |
| InChIKey | KJPIPUPFIHABHL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|