C13H21N5 — CID 54466798
3-[amino-(2,6-dimethylanilino)methylidene]-1,1,2-trimethylguanidine (PubChem CID 54466798) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is 3-[amino-(2,6-dimethylanilino)methylidene]-1,1,2-trimethylguanidine.
| Compound Name | 3-[amino-(2,6-dimethylanilino)methylidene]-1,1,2-trimethylguanidine |
|---|---|
| PubChem CID | 54466798 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 3-[amino-(2,6-dimethylanilino)methylidene]-1,1,2-trimethylguanidine |
| SMILES | C/N=C(/N=C(N)Nc1c(C)cccc1C)N(C)C |
| InChI | InChI=1S/C13H21N5/c1-9-7-6-8-10(2)11(9)16-12(14)17-13(15-3)18(4)5/h6-8H,1-5H3,(H3,14,15,16,17) |
| InChIKey | XFLOJDVXOVETRG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|