C10H15ClN4O — CID 3052078
1-(diaminomethylidene)-3-(2,6-dimethylphenyl)urea;hydrochloride (PubChem CID 3052078) has the molecular formula C10H15ClN4O and a molecular weight of 242.71 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-(2,6-dimethylphenyl)urea;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-3-(2,6-dimethylphenyl)urea;hydrochloride |
|---|---|
| PubChem CID | 3052078 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-(diaminomethylidene)-3-(2,6-dimethylphenyl)urea;hydrochloride |
| SMILES | Cc1cccc(C)c1NC(=O)N=C(N)N.Cl |
| InChI | InChI=1S/C10H14N4O.ClH/c1-6-4-3-5-7(2)8(6)13-10(15)14-9(11)12;/h3-5H,1-2H3,(H5,11,12,13,14,15);1H |
| InChIKey | UTKMXOZLDDVODD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|